C15H7Br2N — CID 134554596
5,7-dibromo-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene (PubChem CID 134554596) has the molecular formula C15H7Br2N and a molecular weight of 361.04 g/mol. Its IUPAC name is 5,7-dibromo-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene.
| Compound Name | 5,7-dibromo-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene |
|---|---|
| PubChem CID | 134554596 |
| Molecular Formula | C15H7Br2N |
| Molecular Weight | 361.04 g/mol |
| Exact Mass | 358.89 |
| IUPAC Name | 5,7-dibromo-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene |
| SMILES | Brc1nc(Br)c2ccc3cccc4ccc1c2c43 |
| InChI | InChI=1S/C15H7Br2N/c16-14-10-6-4-8-2-1-3-9-5-7-11(15(17)18-14)13(10)12(8)9/h1-7H |
| InChIKey | KPKGRSWCJIMMGF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.04 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|