C19H10O3 — CID 87124347
pyrene-1,2,3-tricarbaldehyde (PubChem CID 87124347) has the molecular formula C19H10O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is pyrene-1,2,3-tricarbaldehyde.
| Compound Name | pyrene-1,2,3-tricarbaldehyde |
|---|---|
| PubChem CID | 87124347 |
| Molecular Formula | C19H10O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | pyrene-1,2,3-tricarbaldehyde |
| SMILES | O=Cc1c(C=O)c2ccc3cccc4ccc(c1C=O)c2c34 |
| InChI | InChI=1S/C19H10O3/c20-8-15-13-6-4-11-2-1-3-12-5-7-14(19(13)18(11)12)16(9-21)17(15)10-22/h1-10H |
| InChIKey | YAUJRZPWJDMJGN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|