C20H11NO4 — CID 174701853
2-aminopyrene-4,5,9,10-tetracarbaldehyde (PubChem CID 174701853) has the molecular formula C20H11NO4 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-aminopyrene-4,5,9,10-tetracarbaldehyde.
| Compound Name | 2-aminopyrene-4,5,9,10-tetracarbaldehyde |
|---|---|
| PubChem CID | 174701853 |
| Molecular Formula | C20H11NO4 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-aminopyrene-4,5,9,10-tetracarbaldehyde |
| SMILES | Nc1cc2c(C=O)c(C=O)c3cccc4c(C=O)c(C=O)c(c1)c2c34 |
| InChI | InChI=1S/C20H11NO4/c21-10-4-13-17(8-24)15(6-22)11-2-1-3-12-16(7-23)18(9-25)14(5-10)20(13)19(11)12/h1-9H,21H2 |
| InChIKey | FVLPUHXNPLVFCT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|