C24H22N4 — CID 20789346
1-N,2-N-bis(2,5-dimethylpyrrol-1-yl)acenaphthylene-1,2-diimine (PubChem CID 20789346) has the molecular formula C24H22N4 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-N,2-N-bis(2,5-dimethylpyrrol-1-yl)acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis(2,5-dimethylpyrrol-1-yl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 20789346 |
| Molecular Formula | C24H22N4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-N,2-N-bis(2,5-dimethylpyrrol-1-yl)acenaphthylene-1,2-diimine |
| SMILES | Cc1ccc(C)n1/N=C1C(=N/n2c(C)ccc2C)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C24H22N4/c1-15-11-12-16(2)27(15)25-23-20-9-5-7-19-8-6-10-21(22(19)20)24(23)26-28-17(3)13-14-18(28)4/h5-14H,1-4H3/b25-23+,26-24+ |
| InChIKey | CRIOWZXCCZJEHM-OGGGYYITSA-N |
| XLogP | 5.19 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|