C18H22 — CID 102290615
11-heptylidenetricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 102290615) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 11-heptylidenetricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | 11-heptylidenetricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 102290615 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 11-heptylidenetricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | CCCCCCC=C1C2C=CC1c1ccccc12 |
| InChI | InChI=1S/C18H22/c1-2-3-4-5-6-9-16-17-12-13-18(16)15-11-8-7-10-14(15)17/h7-13,17-18H,2-6H2,1H3 |
| InChIKey | GQLKRZUWTFKQDA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|