About (1E)-1-hexylideneindene
(1E)-1-hexylideneindene (PubChem CID 173434056) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is (1E)-1-hexylideneindene.
Molecular Properties
| Compound Name | (1E)-1-hexylideneindene |
| PubChem CID | 173434056 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (1E)-1-hexylideneindene |
| SMILES | CCCCC/C=C1\C=Cc2ccccc21 |
| InChI | InChI=1S/C15H18/c1-2-3-4-5-8-13-11-12-14-9-6-7-10-15(13)14/h6-12H,2-5H2,1H3/b13-8+ |
| InChIKey | TVJSLYNLXWNYSC-MDWZMJQESA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-hexylideneindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-hexylideneindene?
The IUPAC name of (1E)-1-hexylideneindene (CID 173434056) is (1E)-1-hexylideneindene.
What is the SMILES notation for (1E)-1-hexylideneindene?
The canonical SMILES for (1E)-1-hexylideneindene is CCCCC/C=C1\C=Cc2ccccc21.
What is the InChIKey of (1E)-1-hexylideneindene?
The InChIKey is TVJSLYNLXWNYSC-MDWZMJQESA-N. The full InChI is InChI=1S/C15H18/c1-2-3-4-5-8-13-11-12-14-9-6-7-10-15(13)14/h6-12H,2-5H2,1H3/b13-8+.
What are the key properties of (1E)-1-hexylideneindene?
(1E)-1-hexylideneindene has a molecular weight of 198.31 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-hexylideneindene is sourced from PubChem (CID 173434056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).