About CID 119078419
CID 119078419 (PubChem CID 119078419) has the molecular formula C24H40As2+2
and a molecular weight of 478.43 g/mol.
Molecular Properties
| Compound Name | CID 119078419 |
| PubChem CID | 119078419 |
| Molecular Formula | C24H40As2+2 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | — |
| SMILES | CCCCC[As+](CC)C1C=CC([As+](CC)CCCCC)c2ccccc21 |
| InChI | InChI=1S/C24H40As2/c1-5-9-13-19-25(7-3)23-17-18-24(22-16-12-11-15-21(22)23)26(8-4)20-14-10-6-2/h11-12,15-18,23-24H,5-10,13-14,19-20H2,1-4H3/q+2 |
| InChIKey | YPBOJOHNEXOJOY-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 119078419 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119078419?
The IUPAC name of CID 119078419 (CID 119078419) is not available.
What is the SMILES notation for CID 119078419?
The canonical SMILES for CID 119078419 is CCCCC[As+](CC)C1C=CC([As+](CC)CCCCC)c2ccccc21.
What is the InChIKey of CID 119078419?
The InChIKey is YPBOJOHNEXOJOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40As2/c1-5-9-13-19-25(7-3)23-17-18-24(22-16-12-11-15-21(22)23)26(8-4)20-14-10-6-2/h11-12,15-18,23-24H,5-10,13-14,19-20H2,1-4H3/q+2.
What are the key properties of CID 119078419?
CID 119078419 has a molecular weight of 478.43 g/mol, XLogP of 7.91, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119078419 is sourced from PubChem (CID 119078419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).