About 9-pentoxy-9H-fluorene
9-pentoxy-9H-fluorene (PubChem CID 175299691) has the molecular formula C18H20O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 9-pentoxy-9H-fluorene.
Molecular Properties
| Compound Name | 9-pentoxy-9H-fluorene |
| PubChem CID | 175299691 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 9-pentoxy-9H-fluorene |
| SMILES | CCCCCOC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H20O/c1-2-3-8-13-19-18-16-11-6-4-9-14(16)15-10-5-7-12-17(15)18/h4-7,9-12,18H,2-3,8,13H2,1H3 |
| InChIKey | SNRVGBDKXGWGBI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-pentoxy-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pentoxy-9H-fluorene?
The IUPAC name of 9-pentoxy-9H-fluorene (CID 175299691) is 9-pentoxy-9H-fluorene.
What is the SMILES notation for 9-pentoxy-9H-fluorene?
The canonical SMILES for 9-pentoxy-9H-fluorene is CCCCCOC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9-pentoxy-9H-fluorene?
The InChIKey is SNRVGBDKXGWGBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O/c1-2-3-8-13-19-18-16-11-6-4-9-14(16)15-10-5-7-12-17(15)18/h4-7,9-12,18H,2-3,8,13H2,1H3.
What are the key properties of 9-pentoxy-9H-fluorene?
9-pentoxy-9H-fluorene has a molecular weight of 252.36 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pentoxy-9H-fluorene is sourced from PubChem (CID 175299691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).