C20H30O5 — CID 70405941
7-hydroxy-7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 70405941) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 7-hydroxy-7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | 7-hydroxy-7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70405941 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 7-hydroxy-7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CCCCCC(O)C=CC1C=CC(=O)C1C(O)C=CCCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-5-8-16(21)13-11-15-12-14-18(23)20(15)17(22)9-6-4-7-10-19(24)25/h6,9,11-17,20-22H,2-5,7-8,10H2,1H3,(H,24,25) |
| InChIKey | CPTMAXSIYIDUIE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|