C30H47NO7 — CID 22799118
7-[(1R,2R)-2-[(E)-7-cyanohept-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid (PubChem CID 22799118) has the molecular formula C30H47NO7 and a molecular weight of 533.71 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(E)-7-cyanohept-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-[(E)-7-cyanohept-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid |
|---|---|
| PubChem CID | 22799118 |
| Molecular Formula | C30H47NO7 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | 7-[(1R,2R)-2-[(E)-7-cyanohept-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid |
| SMILES | N#CCCCCC/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCC(OC1CCCCO1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C30H47NO7/c31-21-11-4-2-1-3-6-14-24-18-19-26(32)25(24)15-7-5-10-20-30(29(33)34,37-27-16-8-12-22-35-27)38-28-17-9-13-23-36-28/h6,14,24-25,27-28H,1-5,7-13,15-20,22-23H2,(H,33,34)/b14-6+/t24-,25+,27?,28?,30?/m0/s1 |
| InChIKey | WYZVACRUUHRYAY-WISIEADLSA-N |
| XLogP | 6.43 |
| TPSA | 115.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|