C32H41FO8 — CID 18603616
7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoic acid (PubChem CID 18603616) has the molecular formula C32H41FO8 and a molecular weight of 572.67 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoic acid.
| Compound Name | 7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 18603616 |
| Molecular Formula | C32H41FO8 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoic acid |
| SMILES | O=C1CC[C@H](/C=C/CCOc2ccc(F)cc2)[C@H]1CC=C=CCC(OC1CCCCO1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C32H41FO8/c33-25-15-17-26(18-16-25)37-21-7-3-10-24-14-19-28(34)27(24)11-2-1-6-20-32(31(35)36,40-29-12-4-8-22-38-29)41-30-13-5-9-23-39-30/h2-3,6,10,15-18,24,27,29-30H,4-5,7-9,11-14,19-23H2,(H,35,36)/b10-3+/t1?,24-,27+,29?,30?,32?/m0/s1 |
| InChIKey | XOFZYUYRXCLAGC-ACWYAOMFSA-N |
| XLogP | 6.10 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|