C34H46O8 — CID 88603178
methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-methyl-3,3-bis(oxan-2-yloxy)-2-phenoxyhepta-4,5-dienoate (PubChem CID 88603178) has the molecular formula C34H46O8 and a molecular weight of 582.73 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-methyl-3,3-bis(oxan-2-yloxy)-2-phenoxyhepta-4,5-dienoate.
| Compound Name | methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-methyl-3,3-bis(oxan-2-yloxy)-2-phenoxyhepta-4,5-dienoate |
|---|---|
| PubChem CID | 88603178 |
| Molecular Formula | C34H46O8 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-methyl-3,3-bis(oxan-2-yloxy)-2-phenoxyhepta-4,5-dienoate |
| SMILES | CC/C=C/[C@H]1CCC(=O)[C@@H]1CC=C=CC([16O]C1CCCCO1)([16O]C1CCCCO1)C(C)(Oc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C34H46O8/c1-4-5-15-26-21-22-29(35)28(26)18-9-12-23-34(41-30-19-10-13-24-38-30,42-31-20-11-14-25-39-31)33(2,32(36)37-3)40-27-16-7-6-8-17-27/h5-9,15-17,23,26,28,30-31H,4,10-11,13-14,18-22,24-25H2,1-3H3/b15-5+/t12?,26-,28+,30?,31?,33?,34?/m0/s1/i41+0,42+0 |
| InChIKey | PQLMSZVJIOJMPJ-YZQPSRNUSA-N |
| XLogP | 6.44 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|