C24H29BrO5 — CID 88518585
methyl 2-bromo-7-[(1R,2R,3R)-2-[(E)-but-1-enyl]-3-methyl-5-oxocyclopentyl]-3-(16O)oxidanyl-2-phenoxyhepta-4,5-dienoate (PubChem CID 88518585) has the molecular formula C24H29BrO5 and a molecular weight of 477.39 g/mol. Its IUPAC name is methyl 2-bromo-7-[(1R,2R,3R)-2-[(E)-but-1-enyl]-3-methyl-5-oxocyclopentyl]-3-(16O)oxidanyl-2-phenoxyhepta-4,5-dienoate.
| Compound Name | methyl 2-bromo-7-[(1R,2R,3R)-2-[(E)-but-1-enyl]-3-methyl-5-oxocyclopentyl]-3-(16O)oxidanyl-2-phenoxyhepta-4,5-dienoate |
|---|---|
| PubChem CID | 88518585 |
| Molecular Formula | C24H29BrO5 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | methyl 2-bromo-7-[(1R,2R,3R)-2-[(E)-but-1-enyl]-3-methyl-5-oxocyclopentyl]-3-(16O)oxidanyl-2-phenoxyhepta-4,5-dienoate |
| SMILES | CC/C=C/[C@H]1[C@H](C)CC(=O)[C@@H]1CC=C=CC([16OH])C(Br)(Oc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H29BrO5/c1-4-5-13-19-17(2)16-21(26)20(19)14-9-10-15-22(27)24(25,23(28)29-3)30-18-11-7-6-8-12-18/h5-9,11-13,15,17,19-20,22,27H,4,14,16H2,1-3H3/b13-5+/t10?,17-,19+,20-,22?,24?/m1/s1/i27+0 |
| InChIKey | XUIIZCLKLSILBW-GFYBTERXSA-N |
| XLogP | 4.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|