C23H30O6 — CID 6439523
(2R,3R,4R)-4-hydroxy-2-[(E)-8-hydroxy-7-oxooct-2-enyl]-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentan-1-one (PubChem CID 6439523) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-2-[(E)-8-hydroxy-7-oxooct-2-enyl]-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-2-[(E)-8-hydroxy-7-oxooct-2-enyl]-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 6439523 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-2-[(E)-8-hydroxy-7-oxooct-2-enyl]-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentan-1-one |
| SMILES | O=C(CO)CCC/C=C/C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/C(O)COc1ccccc1 |
| InChI | InChI=1S/C23H30O6/c24-15-17(25)8-4-1-2-7-11-20-21(23(28)14-22(20)27)13-12-18(26)16-29-19-9-5-3-6-10-19/h2-3,5-7,9-10,12-13,18,20-21,23-24,26,28H,1,4,8,11,14-16H2/b7-2+,13-12+/t18?,20-,21-,23-/m1/s1 |
| InChIKey | IWENRSIKXBDZOT-AWVDFVQYSA-N |
| XLogP | 2.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|