C23H27ClO6 — CID 88518655
methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-chloro-3,3-bis(16O)(oxidanyl)-2-phenoxyhepta-4,5-dienoate (PubChem CID 88518655) has the molecular formula C23H27ClO6 and a molecular weight of 434.91 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-chloro-3,3-bis(16O)(oxidanyl)-2-phenoxyhepta-4,5-dienoate.
| Compound Name | methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-chloro-3,3-bis(16O)(oxidanyl)-2-phenoxyhepta-4,5-dienoate |
|---|---|
| PubChem CID | 88518655 |
| Molecular Formula | C23H27ClO6 |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[(E)-but-1-enyl]-5-oxocyclopentyl]-2-chloro-3,3-bis(16O)(oxidanyl)-2-phenoxyhepta-4,5-dienoate |
| SMILES | CC/C=C/[C@H]1CCC(=O)[C@@H]1CC=C=CC([16OH])([16OH])C(Cl)(Oc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C23H27ClO6/c1-3-4-10-17-14-15-20(25)19(17)13-8-9-16-22(27,28)23(24,21(26)29-2)30-18-11-6-5-7-12-18/h4-8,10-12,16-17,19,27-28H,3,13-15H2,1-2H3/b10-4+/t9?,17-,19+,23?/m0/s1/i27+0,28+0 |
| InChIKey | DATLREKCFGYRDB-YZLWHODXSA-N |
| XLogP | 3.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|