C24H30O5 — CID 88680782
methyl 2-hydroxy-7-[(1R,2R)-2-[(E)-4-(3-methylphenoxy)but-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienoate (PubChem CID 88680782) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is methyl 2-hydroxy-7-[(1R,2R)-2-[(E)-4-(3-methylphenoxy)but-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienoate.
| Compound Name | methyl 2-hydroxy-7-[(1R,2R)-2-[(E)-4-(3-methylphenoxy)but-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienoate |
|---|---|
| PubChem CID | 88680782 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | methyl 2-hydroxy-7-[(1R,2R)-2-[(E)-4-(3-methylphenoxy)but-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienoate |
| SMILES | COC(=O)C(O)CC=C=CC[C@H]1C(=O)CC[C@@H]1/C=C/CCOc1cccc(C)c1 |
| InChI | InChI=1S/C24H30O5/c1-18-9-8-11-20(17-18)29-16-7-6-10-19-14-15-22(25)21(19)12-4-3-5-13-23(26)24(27)28-2/h4-6,8-11,17,19,21,23,26H,7,12-16H2,1-2H3/b10-6+/t3?,19-,21+,23?/m0/s1 |
| InChIKey | HVCHUWJDVAMJRJ-UWNFVBBVSA-N |
| XLogP | 3.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|