C18H22O3 — CID 177175748
(3aR,6aS)-4-[(E)-4-(3-methylphenoxy)but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 177175748) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3aR,6aS)-4-[(E)-4-(3-methylphenoxy)but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,6aS)-4-[(E)-4-(3-methylphenoxy)but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 177175748 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (3aR,6aS)-4-[(E)-4-(3-methylphenoxy)but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | Cc1cccc(OCC/C=C/C2CC[C@@H]3OC(=O)C[C@H]23)c1 |
| InChI | InChI=1S/C18H22O3/c1-13-5-4-7-15(11-13)20-10-3-2-6-14-8-9-17-16(14)12-18(19)21-17/h2,4-7,11,14,16-17H,3,8-10,12H2,1H3/b6-2+/t14?,16-,17+/m1/s1 |
| InChIKey | AJBURLLBVBDYLC-WMMFYJRPSA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|