C25H35O6P — CID 11385694
7-[(1R,2R)-3-methoxy-2-[(E)-3-methoxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienyl-methylphosphinic acid (PubChem CID 11385694) has the molecular formula C25H35O6P and a molecular weight of 462.52 g/mol. Its IUPAC name is 7-[(1R,2R)-3-methoxy-2-[(E)-3-methoxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienyl-methylphosphinic acid.
| Compound Name | 7-[(1R,2R)-3-methoxy-2-[(E)-3-methoxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienyl-methylphosphinic acid |
|---|---|
| PubChem CID | 11385694 |
| Molecular Formula | C25H35O6P |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 7-[(1R,2R)-3-methoxy-2-[(E)-3-methoxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]hepta-4,5-dienyl-methylphosphinic acid |
| SMILES | COC(/C=C/[C@H]1C(OC)CC(=O)[C@@H]1CC=C=CCCCP(C)(=O)O)COc1ccccc1 |
| InChI | InChI=1S/C25H35O6P/c1-29-21(19-31-20-12-8-7-9-13-20)15-16-23-22(24(26)18-25(23)30-2)14-10-5-4-6-11-17-32(3,27)28/h4,7-10,12-13,15-16,21-23,25H,6,11,14,17-19H2,1-3H3,(H,27,28)/b16-15+/t5?,21?,22-,23-,25?/m1/s1 |
| InChIKey | QIWOHZZJWAIOLJ-OAHWHONVSA-N |
| XLogP | 4.64 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|