C23H35O6P — CID 102305177
[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enyl]-methylphosphinic acid (PubChem CID 102305177) has the molecular formula C23H35O6P and a molecular weight of 438.50 g/mol. Its IUPAC name is [(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enyl]-methylphosphinic acid.
| Compound Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 102305177 |
| Molecular Formula | C23H35O6P |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]hept-5-enyl]-methylphosphinic acid |
| SMILES | CP(=O)(O)CCCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](O)COc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H35O6P/c1-30(27,28)15-9-4-2-3-8-12-20-21(23(26)16-22(20)25)14-13-18(24)17-29-19-10-6-5-7-11-19/h3,5-8,10-11,13-14,18,20-26H,2,4,9,12,15-17H2,1H3,(H,27,28)/b8-3-,14-13+/t18-,20+,21+,22-,23+/m0/s1 |
| InChIKey | UBWOFUKTLXWXSY-GOZSVGSTSA-N |
| XLogP | 3.36 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|