C24H33ClO6 — CID 70566918
[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enyl] acetate (PubChem CID 70566918) has the molecular formula C24H33ClO6 and a molecular weight of 452.98 g/mol. Its IUPAC name is [(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enyl] acetate.
| Compound Name | [(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enyl] acetate |
|---|---|
| PubChem CID | 70566918 |
| Molecular Formula | C24H33ClO6 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(4-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2ccc(Cl)cc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C24H33ClO6/c1-17(26)30-14-6-4-2-3-5-7-21-22(24(29)15-23(21)28)13-10-19(27)16-31-20-11-8-18(25)9-12-20/h3,5,8-13,19,21-24,27-29H,2,4,6-7,14-16H2,1H3/b5-3-,13-10+/t19-,21-,22-,23+,24-/m1/s1 |
| InChIKey | BCGLYJKXYNAKRD-VASAFYDISA-N |
| XLogP | 3.67 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|