C21H38O — CID 70607428
(Z)-2-methyl-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-en-1-ol (PubChem CID 70607428) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is (Z)-2-methyl-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-en-1-ol.
| Compound Name | (Z)-2-methyl-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 70607428 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (Z)-2-methyl-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-en-1-ol |
| SMILES | CCCCCC/C=C/[C@H]1CCC[C@@H]1C/C=C\CCC(C)CO |
| InChI | InChI=1S/C21H38O/c1-3-4-5-6-7-10-14-20-16-12-17-21(20)15-11-8-9-13-19(2)18-22/h8,10-11,14,19-22H,3-7,9,12-13,15-18H2,1-2H3/b11-8-,14-10+/t19?,20-,21-/m0/s1 |
| InChIKey | GJHTWRITYYJGET-JHDSPEEKSA-N |
| XLogP | 6.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|