C20H37NO — CID 21403181
7-[2-[(E)-oct-1-enyl]cyclopentyl]heptanamide (PubChem CID 21403181) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is 7-[2-[(E)-oct-1-enyl]cyclopentyl]heptanamide.
| Compound Name | 7-[2-[(E)-oct-1-enyl]cyclopentyl]heptanamide |
|---|---|
| PubChem CID | 21403181 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | 7-[2-[(E)-oct-1-enyl]cyclopentyl]heptanamide |
| SMILES | CCCCCC/C=C/C1CCCC1CCCCCCC(N)=O |
| InChI | InChI=1S/C20H37NO/c1-2-3-4-5-6-9-13-18-15-12-16-19(18)14-10-7-8-11-17-20(21)22/h9,13,18-19H,2-8,10-12,14-17H2,1H3,(H2,21,22)/b13-9+ |
| InChIKey | DOLXSYLLFJHGGQ-UKTHLTGXSA-N |
| XLogP | 5.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|