C20H34O4 — CID 140568678
7-[(2S,3R)-2-oct-1-enyloxan-3-yl]hept-5-eneperoxoic acid (PubChem CID 140568678) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 7-[(2S,3R)-2-oct-1-enyloxan-3-yl]hept-5-eneperoxoic acid.
| Compound Name | 7-[(2S,3R)-2-oct-1-enyloxan-3-yl]hept-5-eneperoxoic acid |
|---|---|
| PubChem CID | 140568678 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 7-[(2S,3R)-2-oct-1-enyloxan-3-yl]hept-5-eneperoxoic acid |
| SMILES | CCCCCCC=C[C@H]1OCCC[C@@H]1CC=CCCCC(=O)OO |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-10-15-19-18(14-12-17-23-19)13-9-7-8-11-16-20(21)24-22/h7,9-10,15,18-19,22H,2-6,8,11-14,16-17H2,1H3/t18-,19+/m0/s1 |
| InChIKey | CYPVXJLWNXULSZ-RBUKOAKNSA-N |
| XLogP | 5.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|