C20H34O4 — CID 174032676
(Z)-7-[(3R,6S)-6-hydroxy-2-[(E)-oct-1-enyl]oxan-3-yl]hept-5-enoic acid (PubChem CID 174032676) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (Z)-7-[(3R,6S)-6-hydroxy-2-[(E)-oct-1-enyl]oxan-3-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,6S)-6-hydroxy-2-[(E)-oct-1-enyl]oxan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 174032676 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (Z)-7-[(3R,6S)-6-hydroxy-2-[(E)-oct-1-enyl]oxan-3-yl]hept-5-enoic acid |
| SMILES | CCCCCC/C=C/C1O[C@H](O)CC[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-10-13-18-17(15-16-20(23)24-18)12-9-7-8-11-14-19(21)22/h7,9-10,13,17-18,20,23H,2-6,8,11-12,14-16H2,1H3,(H,21,22)/b9-7-,13-10+/t17-,18?,20-/m0/s1 |
| InChIKey | NIXFHEFNSKYJBX-AAJNRHMYSA-N |
| XLogP | 4.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|