C20H37NaO3 — CID 173420719
sodium;hydride;4-(3-tetradec-1-enyloxiran-2-yl)butanoic acid (PubChem CID 173420719) has the molecular formula C20H37NaO3 and a molecular weight of 348.50 g/mol. Its IUPAC name is sodium;hydride;4-(3-tetradec-1-enyloxiran-2-yl)butanoic acid.
| Compound Name | sodium;hydride;4-(3-tetradec-1-enyloxiran-2-yl)butanoic acid |
|---|---|
| PubChem CID | 173420719 |
| Molecular Formula | C20H37NaO3 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | sodium;hydride;4-(3-tetradec-1-enyloxiran-2-yl)butanoic acid |
| SMILES | CCCCCCCCCCCCC=CC1OC1CCCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C20H36O3.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-19(23-18)16-14-17-20(21)22;;/h13,15,18-19H,2-12,14,16-17H2,1H3,(H,21,22);;/q;+1;-1 |
| InChIKey | AAJOFIBXCIXASX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|