C24H42O2 — CID 88769464
8-[(1S,2S)-2-oct-1-enylcyclopentyl]-2-prop-2-enoxyoctanal (PubChem CID 88769464) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 8-[(1S,2S)-2-oct-1-enylcyclopentyl]-2-prop-2-enoxyoctanal.
| Compound Name | 8-[(1S,2S)-2-oct-1-enylcyclopentyl]-2-prop-2-enoxyoctanal |
|---|---|
| PubChem CID | 88769464 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 8-[(1S,2S)-2-oct-1-enylcyclopentyl]-2-prop-2-enoxyoctanal |
| SMILES | C=CCOC(C=O)CCCCCC[C@H]1CCC[C@@H]1C=CCCCCCC |
| InChI | InChI=1S/C24H42O2/c1-3-5-6-7-8-11-15-22-17-14-18-23(22)16-12-9-10-13-19-24(21-25)26-20-4-2/h4,11,15,21-24H,2-3,5-10,12-14,16-20H2,1H3/t22-,23-,24?/m0/s1 |
| InChIKey | GFZJQGFTXDNCGX-NTZARQNWSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|