C18H28O2 — CID 142188732
2-[(1R)-2-(5-phenylpentyl)cyclopentyl]ethane-1,1-diol (PubChem CID 142188732) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[(1R)-2-(5-phenylpentyl)cyclopentyl]ethane-1,1-diol.
| Compound Name | 2-[(1R)-2-(5-phenylpentyl)cyclopentyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 142188732 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-[(1R)-2-(5-phenylpentyl)cyclopentyl]ethane-1,1-diol |
| SMILES | OC(O)C[C@H]1CCCC1CCCCCc1ccccc1 |
| InChI | InChI=1S/C18H28O2/c19-18(20)14-17-13-7-12-16(17)11-6-2-5-10-15-8-3-1-4-9-15/h1,3-4,8-9,16-20H,2,5-7,10-14H2/t16?,17-/m1/s1 |
| InChIKey | PGUOEVMKXGABSU-ZYMOGRSISA-N |
| XLogP | 3.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|