C26H37NO3 — CID 139437236
[(E)-1-[(2R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]cyclopentyl]-5-phenylpent-1-en-3-yl] formate (PubChem CID 139437236) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is [(E)-1-[(2R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]cyclopentyl]-5-phenylpent-1-en-3-yl] formate.
| Compound Name | [(E)-1-[(2R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]cyclopentyl]-5-phenylpent-1-en-3-yl] formate |
|---|---|
| PubChem CID | 139437236 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | [(E)-1-[(2R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]cyclopentyl]-5-phenylpent-1-en-3-yl] formate |
| SMILES | CCNC(=O)CCC/C=C\C[C@H]1CCCC1/C=C/C(CCc1ccccc1)OC=O |
| InChI | InChI=1S/C26H37NO3/c1-2-27-26(29)16-9-4-3-8-13-23-14-10-15-24(23)18-20-25(30-21-28)19-17-22-11-6-5-7-12-22/h3,5-8,11-12,18,20-21,23-25H,2,4,9-10,13-17,19H2,1H3,(H,27,29)/b8-3-,20-18+/t23-,24?,25?/m0/s1 |
| InChIKey | HPLSXAHUCKTKDK-XBJJWKGPSA-N |
| XLogP | 5.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|