C16H22O — CID 10242966
2-[(E)-5-phenylpent-1-enyl]oxane (PubChem CID 10242966) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(E)-5-phenylpent-1-enyl]oxane.
| Compound Name | 2-[(E)-5-phenylpent-1-enyl]oxane |
|---|---|
| PubChem CID | 10242966 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-[(E)-5-phenylpent-1-enyl]oxane |
| SMILES | C(=C/C1CCCCO1)\CCCc1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-17-16/h1,3-4,6,9-10,12,16H,2,5,7-8,11,13-14H2/b12-6+ |
| InChIKey | NJNBFKPYULDAHA-WUXMJOGZSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|