C30H44N2O9 — CID 66900280
[(3R)-3-[7-(ethylamino)-7-oxohept-2-enyl]-4-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl] 4-nitrooxybutyl carbonate (PubChem CID 66900280) has the molecular formula C30H44N2O9 and a molecular weight of 576.69 g/mol. Its IUPAC name is [(3R)-3-[7-(ethylamino)-7-oxohept-2-enyl]-4-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl] 4-nitrooxybutyl carbonate.
| Compound Name | [(3R)-3-[7-(ethylamino)-7-oxohept-2-enyl]-4-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl] 4-nitrooxybutyl carbonate |
|---|---|
| PubChem CID | 66900280 |
| Molecular Formula | C30H44N2O9 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | [(3R)-3-[7-(ethylamino)-7-oxohept-2-enyl]-4-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl] 4-nitrooxybutyl carbonate |
| SMILES | CCNC(=O)CCCC=CC[C@H]1C(O)CC(OC(=O)OCCCCO[N+](=O)[O-])C1C=C[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C30H44N2O9/c1-2-31-29(35)15-9-4-3-8-14-25-26(19-18-24(33)17-16-23-12-6-5-7-13-23)28(22-27(25)34)41-30(36)39-20-10-11-21-40-32(37)38/h3,5-8,12-13,18-19,24-28,33-34H,2,4,9-11,14-17,20-22H2,1H3,(H,31,35)/t24-,25+,26?,27?,28?/m0/s1 |
| InChIKey | CHBOIJXGRROYDV-VMMDCFEISA-N |
| XLogP | 4.30 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|