C23H36O6S — CID 57232893
methyl 7-[3-ethylsulfonyl-5-(3-hydroxyoct-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoate (PubChem CID 57232893) has the molecular formula C23H36O6S and a molecular weight of 440.60 g/mol. Its IUPAC name is methyl 7-[3-ethylsulfonyl-5-(3-hydroxyoct-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoate.
| Compound Name | methyl 7-[3-ethylsulfonyl-5-(3-hydroxyoct-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoate |
|---|---|
| PubChem CID | 57232893 |
| Molecular Formula | C23H36O6S |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | methyl 7-[3-ethylsulfonyl-5-(3-hydroxyoct-1-enyl)-2-oxocyclopent-3-en-1-ylidene]heptanoate |
| SMILES | CCCCCC(O)C=CC1C=C(S(=O)(=O)CC)C(=O)C1=CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H36O6S/c1-4-6-9-12-19(24)16-15-18-17-21(30(27,28)5-2)23(26)20(18)13-10-7-8-11-14-22(25)29-3/h13,15-19,24H,4-12,14H2,1-3H3 |
| InChIKey | HYYJPNYJGOJCSD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|