C29H51ClHgO6Si — CID 135045944
[1-[(1R,3R,5R,6R,8R)-8-[(E,3S)-3-acetyloxyoct-1-enyl]-6-[tert-butyl(dimethyl)silyl]oxy-2-oxabicyclo[3.2.1]octan-3-yl]-5-methoxy-5-oxopentyl]-chloromercury (PubChem CID 135045944) has the molecular formula C29H51ClHgO6Si and a molecular weight of 759.85 g/mol. Its IUPAC name is [1-[(1R,3R,5R,6R,8R)-8-[(E,3S)-3-acetyloxyoct-1-enyl]-6-[tert-butyl(dimethyl)silyl]oxy-2-oxabicyclo[3.2.1]octan-3-yl]-5-methoxy-5-oxopentyl]-chloromercury.
| Compound Name | [1-[(1R,3R,5R,6R,8R)-8-[(E,3S)-3-acetyloxyoct-1-enyl]-6-[tert-butyl(dimethyl)silyl]oxy-2-oxabicyclo[3.2.1]octan-3-yl]-5-methoxy-5-oxopentyl]-chloromercury |
|---|---|
| PubChem CID | 135045944 |
| Molecular Formula | C29H51ClHgO6Si |
| Molecular Weight | 759.85 g/mol |
| Exact Mass | 760.28 |
| IUPAC Name | [1-[(1R,3R,5R,6R,8R)-8-[(E,3S)-3-acetyloxyoct-1-enyl]-6-[tert-butyl(dimethyl)silyl]oxy-2-oxabicyclo[3.2.1]octan-3-yl]-5-methoxy-5-oxopentyl]-chloromercury |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2C[C@H](C(CCCC(=O)OC)[Hg]Cl)O[C@@H]1C[C@H]2O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C29H51O6Si.ClH.Hg/c1-9-10-11-14-22(33-21(2)30)17-18-24-25-19-23(15-12-13-16-28(31)32-6)34-26(24)20-27(25)35-36(7,8)29(3,4)5;;/h15,17-18,22-27H,9-14,16,19-20H2,1-8H3;1H;/q;;+1/p-1/b18-17+;;/t22-,23-,24+,25+,26+,27+;;/m0../s1 |
| InChIKey | WRZPKEJUIJVKNV-QHVONSQGSA-M |
| XLogP | 7.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.85 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|