C12H20O3 — CID 59917198
2-[(Z)-but-2-enyl]-3,5-dimethoxycyclopentane-1-carbaldehyde (PubChem CID 59917198) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(Z)-but-2-enyl]-3,5-dimethoxycyclopentane-1-carbaldehyde.
| Compound Name | 2-[(Z)-but-2-enyl]-3,5-dimethoxycyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 59917198 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-[(Z)-but-2-enyl]-3,5-dimethoxycyclopentane-1-carbaldehyde |
| SMILES | C/C=C\CC1C(OC)CC(OC)C1C=O |
| InChI | InChI=1S/C12H20O3/c1-4-5-6-9-10(8-13)12(15-3)7-11(9)14-2/h4-5,8-12H,6-7H2,1-3H3/b5-4- |
| InChIKey | LEFFBDCTRHOAGF-PLNGDYQASA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|