C29H45ClO4Si — CID 91222746
methyl 7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2-[4-(2-methyl-1-oxopropan-2-yl)phenyl]cyclopentyl]hept-5-enoate (PubChem CID 91222746) has the molecular formula C29H45ClO4Si and a molecular weight of 521.21 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2-[4-(2-methyl-1-oxopropan-2-yl)phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2-[4-(2-methyl-1-oxopropan-2-yl)phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91222746 |
| Molecular Formula | C29H45ClO4Si |
| Molecular Weight | 521.21 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | methyl 7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2-[4-(2-methyl-1-oxopropan-2-yl)phenyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@@H]1[C@@H](c2ccc(C(C)(C)C=O)cc2)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1Cl |
| InChI | InChI=1S/C29H45ClO4Si/c1-28(2,3)35(7,8)34-25-19-24(30)23(13-11-9-10-12-14-26(32)33-6)27(25)21-15-17-22(18-16-21)29(4,5)20-31/h9,11,15-18,20,23-25,27H,10,12-14,19H2,1-8H3/t23-,24+,25+,27+/m0/s1 |
| InChIKey | IJQYGUXDZPNXNM-AMBDWCSGSA-N |
| XLogP | 7.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.21 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|