C26H45NO5Si — CID 10814562
methyl 6-[(3R,5S)-2-benzyl-5-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-1,2-oxazolidin-3-yl]hexanoate (PubChem CID 10814562) has the molecular formula C26H45NO5Si and a molecular weight of 479.73 g/mol. Its IUPAC name is methyl 6-[(3R,5S)-2-benzyl-5-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-1,2-oxazolidin-3-yl]hexanoate.
| Compound Name | methyl 6-[(3R,5S)-2-benzyl-5-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-1,2-oxazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 10814562 |
| Molecular Formula | C26H45NO5Si |
| Molecular Weight | 479.73 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | methyl 6-[(3R,5S)-2-benzyl-5-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-1,2-oxazolidin-3-yl]hexanoate |
| SMILES | COC(=O)CCCCC[C@@H]1C[C@@H]([C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C26H45NO5Si/c1-20(32-33(6,7)26(2,3)4)25(29)23-18-22(16-12-9-13-17-24(28)30-5)27(31-23)19-21-14-10-8-11-15-21/h8,10-11,14-15,20,22-23,25,29H,9,12-13,16-19H2,1-7H3/t20-,22-,23+,25-/m1/s1 |
| InChIKey | ROVGRJKVQMFPKP-BQXRJHOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|