C25H37FN2O5 — CID 91253512
methyl 7-[(1R,2R,5S)-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate (PubChem CID 91253512) has the molecular formula C25H37FN2O5 and a molecular weight of 464.58 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,5S)-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91253512 |
| Molecular Formula | C25H37FN2O5 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]hept-5-enoate |
| SMILES | CNC(C)(C=C[C@H]1C(NO)C[C@H](O)[C@@H]1CC=CCCCC(=O)OC)COc1ccccc1F |
| InChI | InChI=1S/C25H37FN2O5/c1-25(27-2,17-33-23-12-9-8-11-20(23)26)15-14-18-19(22(29)16-21(18)28-31)10-6-4-5-7-13-24(30)32-3/h4,6,8-9,11-12,14-15,18-19,21-22,27-29,31H,5,7,10,13,16-17H2,1-3H3/t18-,19-,21?,22+,25?/m1/s1 |
| InChIKey | MJXTYVUIIRHIMW-YSYZBNQPSA-N |
| XLogP | 3.37 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|