C22H31NO5S — CID 22970239
(E)-7-[5-hydroxy-3-(hydroxyamino)-2-[(E)-3-hydroxy-4-phenylsulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 22970239) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is (E)-7-[5-hydroxy-3-(hydroxyamino)-2-[(E)-3-hydroxy-4-phenylsulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[5-hydroxy-3-(hydroxyamino)-2-[(E)-3-hydroxy-4-phenylsulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 22970239 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (E)-7-[5-hydroxy-3-(hydroxyamino)-2-[(E)-3-hydroxy-4-phenylsulfanylbut-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1C(O)CC(NO)C1/C=C/C(O)CSc1ccccc1 |
| InChI | InChI=1S/C22H31NO5S/c24-16(15-29-17-8-4-3-5-9-17)12-13-18-19(21(25)14-20(18)23-28)10-6-1-2-7-11-22(26)27/h1,3-6,8-9,12-13,16,18-21,23-25,28H,2,7,10-11,14-15H2,(H,26,27)/b6-1+,13-12+ |
| InChIKey | OIBCVQFRPZEKJT-JHYQVCNUSA-N |
| XLogP | 3.24 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|