C22H31N5O4 — CID 59909503
trans-(1S,3R)-4-(hydroxyamino)-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-ol (PubChem CID 59909503) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is trans-(1S,3R)-4-(hydroxyamino)-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-ol.
| Compound Name | trans-(1S,3R)-4-(hydroxyamino)-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 59909503 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | trans-(1S,3R)-4-(hydroxyamino)-3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-ol |
| SMILES | ONC1C[C@H](O)C(C/C=C\CCCc2nn[nH]n2)[C@H]1/C=C/C(O)COc1ccccc1 |
| InChI | InChI=1S/C22H31N5O4/c28-16(15-31-17-8-4-3-5-9-17)12-13-18-19(21(29)14-20(18)25-30)10-6-1-2-7-11-22-23-26-27-24-22/h1,3-6,8-9,12-13,16,18-21,25,28-30H,2,7,10-11,14-15H2,(H,23,24,26,27)/b6-1-,13-12+/t16?,18-,19?,20?,21+/m1/s1 |
| InChIKey | HNLBVCKQVITOAR-UFHLPKOLSA-N |
| XLogP | 1.81 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|