C30H36BrFO6 — CID 59909479
methyl (Z)-7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-2-[(E,3R)-4-(2-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate (PubChem CID 59909479) has the molecular formula C30H36BrFO6 and a molecular weight of 591.51 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-2-[(E,3R)-4-(2-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-2-[(E,3R)-4-(2-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59909479 |
| Molecular Formula | C30H36BrFO6 |
| Molecular Weight | 591.51 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-2-[(E,3R)-4-(2-fluorophenoxy)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2ccccc2F)[C@H](OCc2ccccc2Br)C[C@@H]1O |
| InChI | InChI=1S/C30H36BrFO6/c1-36-30(35)15-5-3-2-4-11-23-24(17-16-22(33)20-38-28-14-9-8-13-26(28)32)29(18-27(23)34)37-19-21-10-6-7-12-25(21)31/h2,4,6-10,12-14,16-17,22-24,27,29,33-34H,3,5,11,15,18-20H2,1H3/b4-2-,17-16+/t22-,23-,24-,27+,29-/m1/s1 |
| InChIKey | SHYKIYJKVLLAJX-PCHHYYAKSA-N |
| XLogP | 5.76 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|