C24H31ClO6 — CID 6434899
methyl (Z)-7-[2-[(E)-2-[4-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 6434899) has the molecular formula C24H31ClO6 and a molecular weight of 450.96 g/mol. Its IUPAC name is methyl (Z)-7-[2-[(E)-2-[4-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[2-[(E)-2-[4-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 6434899 |
| Molecular Formula | C24H31ClO6 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | methyl (Z)-7-[2-[(E)-2-[4-(4-chlorophenyl)-1,3-dioxolan-2-yl]ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1C(O)CC(O)C1/C=C/C1OCC(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C24H31ClO6/c1-29-23(28)7-5-3-2-4-6-18-19(21(27)14-20(18)26)12-13-24-30-15-22(31-24)16-8-10-17(25)11-9-16/h2,4,8-13,18-22,24,26-27H,3,5-7,14-15H2,1H3/b4-2-,13-12+ |
| InChIKey | ZKSVXYSYWAMBHH-UZSZVRDGSA-N |
| XLogP | 3.96 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|