About methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate
methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate (PubChem CID 76714897) has the molecular formula C25H26BrO2P
and a molecular weight of 469.36 g/mol. Its IUPAC name is methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate.
Molecular Properties
| Compound Name | methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate |
| PubChem CID | 76714897 |
| Molecular Formula | C25H26BrO2P |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate |
| SMILES | COC(=O)C=CCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26BrO2P/c1-28-25(27)20-12-5-13-21-29(26,22-14-6-2-7-15-22,23-16-8-3-9-17-23)24-18-10-4-11-19-24/h2-4,6-12,14-20H,5,13,21H2,1H3 |
| InChIKey | MAPZJOHMFRVVLN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate?
The IUPAC name of methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate (CID 76714897) is methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate.
What is the SMILES notation for methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate?
The canonical SMILES for methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate is COC(=O)C=CCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate?
The InChIKey is MAPZJOHMFRVVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26BrO2P/c1-28-25(27)20-12-5-13-21-29(26,22-14-6-2-7-15-22,23-16-8-3-9-17-23)24-18-10-4-11-19-24/h2-4,6-12,14-20H,5,13,21H2,1H3.
What are the key properties of methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate?
methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate has a molecular weight of 469.36 g/mol, XLogP of 5.34, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[bromo(triphenyl)-λ5-phosphanyl]hex-2-enoate is sourced from PubChem (CID 76714897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).