C22H38O5 — CID 57191528
7-[(2R,3R,5S)-2-(8-ethoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoic acid (PubChem CID 57191528) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 7-[(2R,3R,5S)-2-(8-ethoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoic acid.
| Compound Name | 7-[(2R,3R,5S)-2-(8-ethoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 57191528 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 7-[(2R,3R,5S)-2-(8-ethoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoic acid |
| SMILES | CCOCCCCCCC=C[C@@H]1C(CCCCC=CC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H38O5/c1-2-27-16-12-8-4-3-5-9-13-18-19(21(24)17-20(18)23)14-10-6-7-11-15-22(25)26/h9,11,13,15,18-21,23-24H,2-8,10,12,14,16-17H2,1H3,(H,25,26)/t18-,19?,20-,21+/m1/s1 |
| InChIKey | XSIZUDXOROTQCN-WVVQBRDUSA-N |
| XLogP | 4.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|