C24H30F4O5 — CID 162577264
(E)-7-[(3S,5S)-2-[(E)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-2-enoic acid (PubChem CID 162577264) has the molecular formula C24H30F4O5 and a molecular weight of 474.49 g/mol. Its IUPAC name is (E)-7-[(3S,5S)-2-[(E)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-2-enoic acid.
| Compound Name | (E)-7-[(3S,5S)-2-[(E)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 162577264 |
| Molecular Formula | C24H30F4O5 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (E)-7-[(3S,5S)-2-[(E)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-2-enoic acid |
| SMILES | O=C(O)/C=C/CCCCC1C(/C=C/C(O)CCc2cc(F)cc(C(F)(F)F)c2)[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C24H30F4O5/c25-17-12-15(11-16(13-17)24(26,27)28)7-8-18(29)9-10-20-19(21(30)14-22(20)31)5-3-1-2-4-6-23(32)33/h4,6,9-13,18-22,29-31H,1-3,5,7-8,14H2,(H,32,33)/b6-4+,10-9+/t18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | JWCNNKTWEXBYPF-GSZAEVRLSA-N |
| XLogP | 4.25 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|