C27H39F3N2O7 — CID 89068952
(Z)-N-[1-(dihydroxyamino)oxypropan-2-yl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pent-1-enyl]cyclopentyl]hept-5-enamide (PubChem CID 89068952) has the molecular formula C27H39F3N2O7 and a molecular weight of 560.61 g/mol. Its IUPAC name is (Z)-N-[1-(dihydroxyamino)oxypropan-2-yl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pent-1-enyl]cyclopentyl]hept-5-enamide.
| Compound Name | (Z)-N-[1-(dihydroxyamino)oxypropan-2-yl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pent-1-enyl]cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 89068952 |
| Molecular Formula | C27H39F3N2O7 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | (Z)-N-[1-(dihydroxyamino)oxypropan-2-yl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pent-1-enyl]cyclopentyl]hept-5-enamide |
| SMILES | CC(CON(O)O)NC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)CCc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H39F3N2O7/c1-18(17-39-32(37)38)31-26(36)10-5-3-2-4-9-22-23(25(35)16-24(22)34)14-13-21(33)12-11-19-7-6-8-20(15-19)27(28,29)30/h2,4,6-8,13-15,18,21-25,33-35,37-38H,3,5,9-12,16-17H2,1H3,(H,31,36)/b4-2-,14-13+/t18?,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | CMOHFTJPYTWQQB-USJRSVKOSA-N |
| XLogP | 3.55 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|