C26H39ClN2O7 — CID 89068965
(Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(3-chlorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-[2-(dihydroxyamino)oxypropyl]hept-5-enamide (PubChem CID 89068965) has the molecular formula C26H39ClN2O7 and a molecular weight of 527.06 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(3-chlorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-[2-(dihydroxyamino)oxypropyl]hept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(3-chlorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-[2-(dihydroxyamino)oxypropyl]hept-5-enamide |
|---|---|
| PubChem CID | 89068965 |
| Molecular Formula | C26H39ClN2O7 |
| Molecular Weight | 527.06 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(3-chlorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-[2-(dihydroxyamino)oxypropyl]hept-5-enamide |
| SMILES | CC(CNC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)CCc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)ON(O)O |
| InChI | InChI=1S/C26H39ClN2O7/c1-18(36-29(34)35)17-28-26(33)10-5-3-2-4-9-22-23(25(32)16-24(22)31)14-13-21(30)12-11-19-7-6-8-20(27)15-19/h2,4,6-8,13-15,18,21-25,30-32,34-35H,3,5,9-12,16-17H2,1H3,(H,28,33)/b4-2-,14-13+/t18?,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | SPGDRDPLEHBEPU-USJRSVKOSA-N |
| XLogP | 3.18 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.06 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|