C22H34O5 — CID 163997418
(E)-7-[(1R,2R,3R)-3,5-dihydroxy-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]cyclopentyl]hept-2-enoic acid (PubChem CID 163997418) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (E)-7-[(1R,2R,3R)-3,5-dihydroxy-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]cyclopentyl]hept-2-enoic acid.
| Compound Name | (E)-7-[(1R,2R,3R)-3,5-dihydroxy-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]cyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 163997418 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (E)-7-[(1R,2R,3R)-3,5-dihydroxy-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]cyclopentyl]hept-2-enoic acid |
| SMILES | CCC#CC[C@H](C)[C@H](O)/C=C/[C@H]1[C@H](O)CC(O)[C@@H]1CCCC/C=C/C(=O)O |
| InChI | InChI=1S/C22H34O5/c1-3-4-7-10-16(2)19(23)14-13-18-17(20(24)15-21(18)25)11-8-5-6-9-12-22(26)27/h9,12-14,16-21,23-25H,3,5-6,8,10-11,15H2,1-2H3,(H,26,27)/b12-9+,14-13+/t16-,17+,18+,19+,20?,21+/m0/s1 |
| InChIKey | UFXWPNINJKOUSD-XDRCXBJNSA-N |
| XLogP | 2.90 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|