C22H29F2O5- — CID 171318979
5-[3,3-difluoro-5-hydroxy-4-(3-hydroxy-4-methylnon-1-en-6-ynyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 171318979) has the molecular formula C22H29F2O5- and a molecular weight of 411.47 g/mol. Its IUPAC name is 5-[3,3-difluoro-5-hydroxy-4-(3-hydroxy-4-methylnon-1-en-6-ynyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | 5-[3,3-difluoro-5-hydroxy-4-(3-hydroxy-4-methylnon-1-en-6-ynyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 171318979 |
| Molecular Formula | C22H29F2O5- |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 5-[3,3-difluoro-5-hydroxy-4-(3-hydroxy-4-methylnon-1-en-6-ynyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | CCC#CCC(C)C(O)C=CC1C(O)CC2OC(=CCCCC(=O)[O-])C(F)(F)C21 |
| InChI | InChI=1S/C22H30F2O5/c1-3-4-5-8-14(2)16(25)12-11-15-17(26)13-18-21(15)22(23,24)19(29-18)9-6-7-10-20(27)28/h9,11-12,14-18,21,25-26H,3,6-8,10,13H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | PVHIRYQSPDZLLG-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|