C23H28F2O5 — CID 67625983
5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid (PubChem CID 67625983) has the molecular formula C23H28F2O5 and a molecular weight of 422.47 g/mol. Its IUPAC name is 5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid.
| Compound Name | 5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 67625983 |
| Molecular Formula | C23H28F2O5 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILES | Cc1cccc(C[C@H](O)C=C[C@@H]2[C@@H]3[C@H](C[C@H]2O)OC(=CCCCC(=O)O)C3(F)F)c1 |
| InChI | InChI=1S/C23H28F2O5/c1-14-5-4-6-15(11-14)12-16(26)9-10-17-18(27)13-19-22(17)23(24,25)20(30-19)7-2-3-8-21(28)29/h4-7,9-11,16-19,22,26-27H,2-3,8,12-13H2,1H3,(H,28,29)/t16-,17+,18-,19+,22-/m1/s1 |
| InChIKey | UGDZTWMNPNUMBU-GOYZHWMFSA-N |
| XLogP | 3.62 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|