C22H30F2O5 — CID 67626826
5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-methylnon-1-en-6-yn-5-yl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid (PubChem CID 67626826) has the molecular formula C22H30F2O5 and a molecular weight of 412.47 g/mol. Its IUPAC name is 5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-methylnon-1-en-6-yn-5-yl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid.
| Compound Name | 5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-methylnon-1-en-6-yn-5-yl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 67626826 |
| Molecular Formula | C22H30F2O5 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 5-[(3aR,4R,5R,6aS)-3,3-difluoro-5-hydroxy-4-[(3S)-3-hydroxy-4-methylnon-1-en-6-yn-5-yl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILES | C=C[C@H](O)C(C)C(C#CCC)[C@@H]1[C@@H]2[C@H](C[C@H]1O)OC(=CCCCC(=O)O)C2(F)F |
| InChI | InChI=1S/C22H30F2O5/c1-4-6-9-14(13(3)15(25)5-2)20-16(26)12-17-21(20)22(23,24)18(29-17)10-7-8-11-19(27)28/h5,10,13-17,20-21,25-26H,2,4,7-8,11-12H2,1,3H3,(H,27,28)/t13?,14?,15-,16+,17-,20-,21-/m0/s1 |
| InChIKey | IUQJGGDPBBLUJQ-NIFBELHGSA-N |
| XLogP | 3.37 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|