C22H38O4 — CID 56612419
5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(1S)-1-hydroxy-4-methyloctyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid (PubChem CID 56612419) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(1S)-1-hydroxy-4-methyloctyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid.
| Compound Name | 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(1S)-1-hydroxy-4-methyloctyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 56612419 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(1S)-1-hydroxy-4-methyloctyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| SMILES | CCCCC(C)CC[C@H](O)[C@H]1[C@H]2CC(=CCCCC(=O)O)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H38O4/c1-3-4-7-15(2)10-11-19(23)22-18-13-16(8-5-6-9-21(25)26)12-17(18)14-20(22)24/h8,15,17-20,22-24H,3-7,9-14H2,1-2H3,(H,25,26)/t15?,17-,18-,19-,20+,22+/m0/s1 |
| InChIKey | KVVWKWULKHQXDJ-JZMUZCDLSA-N |
| XLogP | 4.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|